C20H24F2O — CID 19436442
1-(difluoromethoxy)-4-(4-heptylphenyl)benzene (PubChem CID 19436442) has the molecular formula C20H24F2O and a molecular weight of 318.41 g/mol. Its IUPAC name is 1-(difluoromethoxy)-4-(4-heptylphenyl)benzene.
| Compound Name | 1-(difluoromethoxy)-4-(4-heptylphenyl)benzene |
|---|---|
| PubChem CID | 19436442 |
| Molecular Formula | C20H24F2O |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 1-(difluoromethoxy)-4-(4-heptylphenyl)benzene |
| SMILES | CCCCCCCc1ccc(-c2ccc(OC(F)F)cc2)cc1 |
| InChI | InChI=1S/C20H24F2O/c1-2-3-4-5-6-7-16-8-10-17(11-9-16)18-12-14-19(15-13-18)23-20(21)22/h8-15,20H,2-7H2,1H3 |
| InChIKey | ZDJBEURWQOFMPB-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|