C28H24F18O3 — CID 134604952
1-[1,3-bis[[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy]propan-2-yloxy]-4-(4-pentylphenyl)benzene (PubChem CID 134604952) has the molecular formula C28H24F18O3 and a molecular weight of 750.46 g/mol. Its IUPAC name is 1-[1,3-bis[[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy]propan-2-yloxy]-4-(4-pentylphenyl)benzene.
| Compound Name | 1-[1,3-bis[[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy]propan-2-yloxy]-4-(4-pentylphenyl)benzene |
|---|---|
| PubChem CID | 134604952 |
| Molecular Formula | C28H24F18O3 |
| Molecular Weight | 750.46 g/mol |
| Exact Mass | 750.14 |
| IUPAC Name | 1-[1,3-bis[[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy]propan-2-yloxy]-4-(4-pentylphenyl)benzene |
| SMILES | CCCCCc1ccc(-c2ccc(OC(COC(C(F)(F)F)(C(F)(F)F)C(F)(F)F)COC(C(F)(F)F)(C(F)(F)F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C28H24F18O3/c1-2-3-4-5-16-6-8-17(9-7-16)18-10-12-19(13-11-18)49-20(14-47-21(23(29,30)31,24(32,33)34)25(35,36)37)15-48-22(26(38,39)40,27(41,42)43)28(44,45)46/h6-13,20H,2-5,14-15H2,1H3 |
| InChIKey | LBDOWEMSUXASBS-UHFFFAOYSA-N |
| XLogP | 10.72 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.46 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|