C24H34F2O — CID 161273010
1-(difluoromethoxy)-4-(4-propylphenyl)benzene;octane (PubChem CID 161273010) has the molecular formula C24H34F2O and a molecular weight of 376.53 g/mol. Its IUPAC name is 1-(difluoromethoxy)-4-(4-propylphenyl)benzene;octane.
| Compound Name | 1-(difluoromethoxy)-4-(4-propylphenyl)benzene;octane |
|---|---|
| PubChem CID | 161273010 |
| Molecular Formula | C24H34F2O |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | 1-(difluoromethoxy)-4-(4-propylphenyl)benzene;octane |
| SMILES | CCCCCCCC.CCCc1ccc(-c2ccc(OC(F)F)cc2)cc1 |
| InChI | InChI=1S/C16H16F2O.C8H18/c1-2-3-12-4-6-13(7-5-12)14-8-10-15(11-9-14)19-16(17)18;1-3-5-7-8-6-4-2/h4-11,16H,2-3H2,1H3;3-8H2,1-2H3 |
| InChIKey | VEBOFDGSMWPZPK-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|