C18H28F4O — CID 143474263
butane;1-hexyl-4-(1,1,2,2-tetrafluoroethoxy)benzene (PubChem CID 143474263) has the molecular formula C18H28F4O and a molecular weight of 336.41 g/mol. Its IUPAC name is butane;1-hexyl-4-(1,1,2,2-tetrafluoroethoxy)benzene.
| Compound Name | butane;1-hexyl-4-(1,1,2,2-tetrafluoroethoxy)benzene |
|---|---|
| PubChem CID | 143474263 |
| Molecular Formula | C18H28F4O |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | butane;1-hexyl-4-(1,1,2,2-tetrafluoroethoxy)benzene |
| SMILES | CCCC.CCCCCCc1ccc(OC(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C14H18F4O.C4H10/c1-2-3-4-5-6-11-7-9-12(10-8-11)19-14(17,18)13(15)16;1-3-4-2/h7-10,13H,2-6H2,1H3;3-4H2,1-2H3 |
| InChIKey | WZAQBYWGGZZDTN-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|