C31H36F4O2 — CID 70178127
1-[difluoro-(4-hexylphenoxy)methyl]-4-[difluoro-(4-pentylphenoxy)methyl]benzene (PubChem CID 70178127) has the molecular formula C31H36F4O2 and a molecular weight of 516.62 g/mol. Its IUPAC name is 1-[difluoro-(4-hexylphenoxy)methyl]-4-[difluoro-(4-pentylphenoxy)methyl]benzene.
| Compound Name | 1-[difluoro-(4-hexylphenoxy)methyl]-4-[difluoro-(4-pentylphenoxy)methyl]benzene |
|---|---|
| PubChem CID | 70178127 |
| Molecular Formula | C31H36F4O2 |
| Molecular Weight | 516.62 g/mol |
| Exact Mass | 516.27 |
| IUPAC Name | 1-[difluoro-(4-hexylphenoxy)methyl]-4-[difluoro-(4-pentylphenoxy)methyl]benzene |
| SMILES | CCCCCCc1ccc(OC(F)(F)c2ccc(C(F)(F)Oc3ccc(CCCCC)cc3)cc2)cc1 |
| InChI | InChI=1S/C31H36F4O2/c1-3-5-7-9-11-25-14-22-29(23-15-25)37-31(34,35)27-18-16-26(17-19-27)30(32,33)36-28-20-12-24(13-21-28)10-8-6-4-2/h12-23H,3-11H2,1-2H3 |
| InChIKey | DTSPNVNDNOLPTQ-UHFFFAOYSA-N |
| XLogP | 9.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.62 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|