C26H26F4O2 — CID 70176489
1-[(4-butylphenoxy)-difluoromethyl]-4-[(4-ethylphenoxy)-difluoromethyl]benzene (PubChem CID 70176489) has the molecular formula C26H26F4O2 and a molecular weight of 446.48 g/mol. Its IUPAC name is 1-[(4-butylphenoxy)-difluoromethyl]-4-[(4-ethylphenoxy)-difluoromethyl]benzene.
| Compound Name | 1-[(4-butylphenoxy)-difluoromethyl]-4-[(4-ethylphenoxy)-difluoromethyl]benzene |
|---|---|
| PubChem CID | 70176489 |
| Molecular Formula | C26H26F4O2 |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 1-[(4-butylphenoxy)-difluoromethyl]-4-[(4-ethylphenoxy)-difluoromethyl]benzene |
| SMILES | CCCCc1ccc(OC(F)(F)c2ccc(C(F)(F)Oc3ccc(CC)cc3)cc2)cc1 |
| InChI | InChI=1S/C26H26F4O2/c1-3-5-6-20-9-17-24(18-10-20)32-26(29,30)22-13-11-21(12-14-22)25(27,28)31-23-15-7-19(4-2)8-16-23/h7-18H,3-6H2,1-2H3 |
| InChIKey | CBVLEAKKVOXWSD-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |