C26H25F5O — CID 70176561
1-butyl-4-[difluoro-[4-[2-[4-(trifluoromethyl)phenyl]ethyl]phenoxy]methyl]benzene (PubChem CID 70176561) has the molecular formula C26H25F5O and a molecular weight of 448.48 g/mol. Its IUPAC name is 1-butyl-4-[difluoro-[4-[2-[4-(trifluoromethyl)phenyl]ethyl]phenoxy]methyl]benzene.
| Compound Name | 1-butyl-4-[difluoro-[4-[2-[4-(trifluoromethyl)phenyl]ethyl]phenoxy]methyl]benzene |
|---|---|
| PubChem CID | 70176561 |
| Molecular Formula | C26H25F5O |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 1-butyl-4-[difluoro-[4-[2-[4-(trifluoromethyl)phenyl]ethyl]phenoxy]methyl]benzene |
| SMILES | CCCCc1ccc(C(F)(F)Oc2ccc(CCc3ccc(C(F)(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C26H25F5O/c1-2-3-4-19-9-15-23(16-10-19)26(30,31)32-24-17-11-21(12-18-24)6-5-20-7-13-22(14-8-20)25(27,28)29/h7-18H,2-6H2,1H3 |
| InChIKey | VUAYYLFFIKVRRM-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |