C32H29F5O — CID 58953112
3-(difluoromethyl)-1-[4-[difluoro-[4-(4-pentylphenyl)phenyl]methoxy]phenyl]-2-fluoro-4-methylbenzene (PubChem CID 58953112) has the molecular formula C32H29F5O and a molecular weight of 524.57 g/mol. Its IUPAC name is 3-(difluoromethyl)-1-[4-[difluoro-[4-(4-pentylphenyl)phenyl]methoxy]phenyl]-2-fluoro-4-methylbenzene.
| Compound Name | 3-(difluoromethyl)-1-[4-[difluoro-[4-(4-pentylphenyl)phenyl]methoxy]phenyl]-2-fluoro-4-methylbenzene |
|---|---|
| PubChem CID | 58953112 |
| Molecular Formula | C32H29F5O |
| Molecular Weight | 524.57 g/mol |
| Exact Mass | 524.21 |
| IUPAC Name | 3-(difluoromethyl)-1-[4-[difluoro-[4-(4-pentylphenyl)phenyl]methoxy]phenyl]-2-fluoro-4-methylbenzene |
| SMILES | CCCCCc1ccc(-c2ccc(C(F)(F)Oc3ccc(-c4ccc(C)c(C(F)F)c4F)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H29F5O/c1-3-4-5-6-22-8-10-23(11-9-22)24-12-16-26(17-13-24)32(36,37)38-27-18-14-25(15-19-27)28-20-7-21(2)29(30(28)33)31(34)35/h7-20,31H,3-6H2,1-2H3 |
| InChIKey | SYZSBLNOHNFRAU-UHFFFAOYSA-N |
| XLogP | 10.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.57 |
| LogP ≤ 5 | 10.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|