C36H28F6O — CID 59329880
4-[difluoro-(4-pentylphenyl)methoxy]-1-[4-[4-(3,4-difluorophenyl)-3-fluorophenyl]phenyl]-2-fluorobenzene (PubChem CID 59329880) has the molecular formula C36H28F6O and a molecular weight of 590.61 g/mol. Its IUPAC name is 4-[difluoro-(4-pentylphenyl)methoxy]-1-[4-[4-(3,4-difluorophenyl)-3-fluorophenyl]phenyl]-2-fluorobenzene.
| Compound Name | 4-[difluoro-(4-pentylphenyl)methoxy]-1-[4-[4-(3,4-difluorophenyl)-3-fluorophenyl]phenyl]-2-fluorobenzene |
|---|---|
| PubChem CID | 59329880 |
| Molecular Formula | C36H28F6O |
| Molecular Weight | 590.61 g/mol |
| Exact Mass | 590.20 |
| IUPAC Name | 4-[difluoro-(4-pentylphenyl)methoxy]-1-[4-[4-(3,4-difluorophenyl)-3-fluorophenyl]phenyl]-2-fluorobenzene |
| SMILES | CCCCCc1ccc(C(F)(F)Oc2ccc(-c3ccc(-c4ccc(-c5ccc(F)c(F)c5)c(F)c4)cc3)c(F)c2)cc1 |
| InChI | InChI=1S/C36H28F6O/c1-2-3-4-5-23-6-14-28(15-7-23)36(41,42)43-29-16-18-30(34(39)22-29)25-10-8-24(9-11-25)26-12-17-31(33(38)20-26)27-13-19-32(37)35(40)21-27/h6-22H,2-5H2,1H3 |
| InChIKey | ONJMXSZSPYOLIA-UHFFFAOYSA-N |
| XLogP | 11.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.61 |
| LogP ≤ 5 | 11.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|