C36H27F7O — CID 59329166
1-[[4-[4-(3,4-difluorophenyl)-3-fluorophenyl]phenoxy]-difluoromethyl]-2-fluoro-4-(2-fluoro-4-pentylphenyl)benzene (PubChem CID 59329166) has the molecular formula C36H27F7O and a molecular weight of 608.60 g/mol. Its IUPAC name is 1-[[4-[4-(3,4-difluorophenyl)-3-fluorophenyl]phenoxy]-difluoromethyl]-2-fluoro-4-(2-fluoro-4-pentylphenyl)benzene.
| Compound Name | 1-[[4-[4-(3,4-difluorophenyl)-3-fluorophenyl]phenoxy]-difluoromethyl]-2-fluoro-4-(2-fluoro-4-pentylphenyl)benzene |
|---|---|
| PubChem CID | 59329166 |
| Molecular Formula | C36H27F7O |
| Molecular Weight | 608.60 g/mol |
| Exact Mass | 608.20 |
| IUPAC Name | 1-[[4-[4-(3,4-difluorophenyl)-3-fluorophenyl]phenoxy]-difluoromethyl]-2-fluoro-4-(2-fluoro-4-pentylphenyl)benzene |
| SMILES | CCCCCc1ccc(-c2ccc(C(F)(F)Oc3ccc(-c4ccc(-c5ccc(F)c(F)c5)c(F)c4)cc3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C36H27F7O/c1-2-3-4-5-22-6-14-28(32(38)18-22)25-10-16-30(34(40)20-25)36(42,43)44-27-12-7-23(8-13-27)24-9-15-29(33(39)19-24)26-11-17-31(37)35(41)21-26/h6-21H,2-5H2,1H3 |
| InChIKey | NUOYOWDQXYDIPY-UHFFFAOYSA-N |
| XLogP | 11.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.60 |
| LogP ≤ 5 | 11.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|