C36H37F5O — CID 134602727
4-[8-[4-(4-butylphenyl)phenoxy]-8,8-difluorooctyl]-1-(3,4-difluorophenyl)-2-fluorobenzene (PubChem CID 134602727) has the molecular formula C36H37F5O and a molecular weight of 580.68 g/mol. Its IUPAC name is 4-[8-[4-(4-butylphenyl)phenoxy]-8,8-difluorooctyl]-1-(3,4-difluorophenyl)-2-fluorobenzene.
| Compound Name | 4-[8-[4-(4-butylphenyl)phenoxy]-8,8-difluorooctyl]-1-(3,4-difluorophenyl)-2-fluorobenzene |
|---|---|
| PubChem CID | 134602727 |
| Molecular Formula | C36H37F5O |
| Molecular Weight | 580.68 g/mol |
| Exact Mass | 580.28 |
| IUPAC Name | 4-[8-[4-(4-butylphenyl)phenoxy]-8,8-difluorooctyl]-1-(3,4-difluorophenyl)-2-fluorobenzene |
| SMILES | CCCCc1ccc(-c2ccc(OC(F)(F)CCCCCCCc3ccc(-c4ccc(F)c(F)c4)c(F)c3)cc2)cc1 |
| InChI | InChI=1S/C36H37F5O/c1-2-3-9-26-11-14-28(15-12-26)29-16-19-31(20-17-29)42-36(40,41)23-8-6-4-5-7-10-27-13-21-32(34(38)24-27)30-18-22-33(37)35(39)25-30/h11-22,24-25H,2-10,23H2,1H3 |
| InChIKey | WVCFVWYSJTWEQZ-UHFFFAOYSA-N |
| XLogP | 11.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.68 |
| LogP ≤ 5 | 11.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|