C34H32F3NO — CID 134602728
4-[4-[1,1-difluoro-8-[3-fluoro-4-(4-methylphenyl)phenyl]octoxy]phenyl]benzonitrile (PubChem CID 134602728) has the molecular formula C34H32F3NO and a molecular weight of 527.63 g/mol. Its IUPAC name is 4-[4-[1,1-difluoro-8-[3-fluoro-4-(4-methylphenyl)phenyl]octoxy]phenyl]benzonitrile.
| Compound Name | 4-[4-[1,1-difluoro-8-[3-fluoro-4-(4-methylphenyl)phenyl]octoxy]phenyl]benzonitrile |
|---|---|
| PubChem CID | 134602728 |
| Molecular Formula | C34H32F3NO |
| Molecular Weight | 527.63 g/mol |
| Exact Mass | 527.24 |
| IUPAC Name | 4-[4-[1,1-difluoro-8-[3-fluoro-4-(4-methylphenyl)phenyl]octoxy]phenyl]benzonitrile |
| SMILES | Cc1ccc(-c2ccc(CCCCCCCC(F)(F)Oc3ccc(-c4ccc(C#N)cc4)cc3)cc2F)cc1 |
| InChI | InChI=1S/C34H32F3NO/c1-25-8-13-30(14-9-25)32-21-12-26(23-33(32)35)7-5-3-2-4-6-22-34(36,37)39-31-19-17-29(18-20-31)28-15-10-27(24-38)11-16-28/h8-21,23H,2-7,22H2,1H3 |
| InChIKey | MJBWHVPTDVXAQU-UHFFFAOYSA-N |
| XLogP | 9.89 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.63 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|