C36H36F6O2 — CID 155259559
2-methyl-1-[4-(trifluoromethoxy)phenyl]-4-[9-[4-[4-(trifluoromethoxy)phenyl]phenyl]nonyl]benzene (PubChem CID 155259559) has the molecular formula C36H36F6O2 and a molecular weight of 614.67 g/mol. Its IUPAC name is 2-methyl-1-[4-(trifluoromethoxy)phenyl]-4-[9-[4-[4-(trifluoromethoxy)phenyl]phenyl]nonyl]benzene.
| Compound Name | 2-methyl-1-[4-(trifluoromethoxy)phenyl]-4-[9-[4-[4-(trifluoromethoxy)phenyl]phenyl]nonyl]benzene |
|---|---|
| PubChem CID | 155259559 |
| Molecular Formula | C36H36F6O2 |
| Molecular Weight | 614.67 g/mol |
| Exact Mass | 614.26 |
| IUPAC Name | 2-methyl-1-[4-(trifluoromethoxy)phenyl]-4-[9-[4-[4-(trifluoromethoxy)phenyl]phenyl]nonyl]benzene |
| SMILES | Cc1cc(CCCCCCCCCc2ccc(-c3ccc(OC(F)(F)F)cc3)cc2)ccc1-c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C36H36F6O2/c1-26-25-28(13-24-34(26)31-18-22-33(23-19-31)44-36(40,41)42)10-8-6-4-2-3-5-7-9-27-11-14-29(15-12-27)30-16-20-32(21-17-30)43-35(37,38)39/h11-25H,2-10H2,1H3 |
| InChIKey | BDCXVZPLGCHWMZ-UHFFFAOYSA-N |
| XLogP | 11.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.67 |
| LogP ≤ 5 | 11.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|