C25H23F5O — CID 70388526
2,3-difluoro-1-(4-hexylphenyl)-4-[4-(trifluoromethoxy)phenyl]benzene (PubChem CID 70388526) has the molecular formula C25H23F5O and a molecular weight of 434.45 g/mol. Its IUPAC name is 2,3-difluoro-1-(4-hexylphenyl)-4-[4-(trifluoromethoxy)phenyl]benzene.
| Compound Name | 2,3-difluoro-1-(4-hexylphenyl)-4-[4-(trifluoromethoxy)phenyl]benzene |
|---|---|
| PubChem CID | 70388526 |
| Molecular Formula | C25H23F5O |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 2,3-difluoro-1-(4-hexylphenyl)-4-[4-(trifluoromethoxy)phenyl]benzene |
| SMILES | CCCCCCc1ccc(-c2ccc(-c3ccc(OC(F)(F)F)cc3)c(F)c2F)cc1 |
| InChI | InChI=1S/C25H23F5O/c1-2-3-4-5-6-17-7-9-18(10-8-17)21-15-16-22(24(27)23(21)26)19-11-13-20(14-12-19)31-25(28,29)30/h7-16H,2-6H2,1H3 |
| InChIKey | QIRMBGVPOSPRGU-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|