C32H28F4O — CID 139850527
1-fluoro-6-[2-(4-heptylphenyl)ethynyl]-2-[4-(trifluoromethoxy)phenyl]naphthalene (PubChem CID 139850527) has the molecular formula C32H28F4O and a molecular weight of 504.57 g/mol. Its IUPAC name is 1-fluoro-6-[2-(4-heptylphenyl)ethynyl]-2-[4-(trifluoromethoxy)phenyl]naphthalene.
| Compound Name | 1-fluoro-6-[2-(4-heptylphenyl)ethynyl]-2-[4-(trifluoromethoxy)phenyl]naphthalene |
|---|---|
| PubChem CID | 139850527 |
| Molecular Formula | C32H28F4O |
| Molecular Weight | 504.57 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | 1-fluoro-6-[2-(4-heptylphenyl)ethynyl]-2-[4-(trifluoromethoxy)phenyl]naphthalene |
| SMILES | CCCCCCCc1ccc(C#Cc2ccc3c(F)c(-c4ccc(OC(F)(F)F)cc4)ccc3c2)cc1 |
| InChI | InChI=1S/C32H28F4O/c1-2-3-4-5-6-7-23-8-10-24(11-9-23)12-13-25-14-20-30-27(22-25)17-21-29(31(30)33)26-15-18-28(19-16-26)37-32(34,35)36/h8-11,14-22H,2-7H2,1H3 |
| InChIKey | DWKGVNVADWGKOD-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.57 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|