C30H20F4O — CID 139850671
1-fluoro-6-[2-(4-propylphenyl)ethynyl]-2-[2-[4-(trifluoromethoxy)phenyl]ethynyl]naphthalene (PubChem CID 139850671) has the molecular formula C30H20F4O and a molecular weight of 472.48 g/mol. Its IUPAC name is 1-fluoro-6-[2-(4-propylphenyl)ethynyl]-2-[2-[4-(trifluoromethoxy)phenyl]ethynyl]naphthalene.
| Compound Name | 1-fluoro-6-[2-(4-propylphenyl)ethynyl]-2-[2-[4-(trifluoromethoxy)phenyl]ethynyl]naphthalene |
|---|---|
| PubChem CID | 139850671 |
| Molecular Formula | C30H20F4O |
| Molecular Weight | 472.48 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | 1-fluoro-6-[2-(4-propylphenyl)ethynyl]-2-[2-[4-(trifluoromethoxy)phenyl]ethynyl]naphthalene |
| SMILES | CCCc1ccc(C#Cc2ccc3c(F)c(C#Cc4ccc(OC(F)(F)F)cc4)ccc3c2)cc1 |
| InChI | InChI=1S/C30H20F4O/c1-2-3-21-4-6-22(7-5-21)8-9-24-13-19-28-26(20-24)16-15-25(29(28)31)14-10-23-11-17-27(18-12-23)35-30(32,33)34/h4-7,11-13,15-20H,2-3H2,1H3 |
| InChIKey | VXCAGABBNDLJRF-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.48 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|