C32H20F6O — CID 139850611
2-[2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]ethynyl]-1-fluoro-6-[2-[4-[(E)-pent-3-enyl]phenyl]ethynyl]naphthalene (PubChem CID 139850611) has the molecular formula C32H20F6O and a molecular weight of 534.50 g/mol. Its IUPAC name is 2-[2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]ethynyl]-1-fluoro-6-[2-[4-[(E)-pent-3-enyl]phenyl]ethynyl]naphthalene.
| Compound Name | 2-[2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]ethynyl]-1-fluoro-6-[2-[4-[(E)-pent-3-enyl]phenyl]ethynyl]naphthalene |
|---|---|
| PubChem CID | 139850611 |
| Molecular Formula | C32H20F6O |
| Molecular Weight | 534.50 g/mol |
| Exact Mass | 534.14 |
| IUPAC Name | 2-[2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]ethynyl]-1-fluoro-6-[2-[4-[(E)-pent-3-enyl]phenyl]ethynyl]naphthalene |
| SMILES | C/C=C/CCc1ccc(C#Cc2ccc3c(F)c(C#Cc4cc(F)c(OC(F)(F)F)c(F)c4)ccc3c2)cc1 |
| InChI | InChI=1S/C32H20F6O/c1-2-3-4-5-21-6-8-22(9-7-21)10-11-23-13-17-27-26(18-23)16-15-25(30(27)35)14-12-24-19-28(33)31(29(34)20-24)39-32(36,37)38/h2-3,6-9,13,15-20H,4-5H2,1H3/b3-2+ |
| InChIKey | PGWCFIHBFUFBAY-NSCUHMNNSA-N |
| XLogP | 8.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.50 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|