C20H15F5O — CID 139750895
1,3-difluoro-5-[2-[4-[(E)-pent-3-enyl]phenyl]ethynyl]-2-(trifluoromethoxy)benzene (PubChem CID 139750895) has the molecular formula C20H15F5O and a molecular weight of 366.33 g/mol. Its IUPAC name is 1,3-difluoro-5-[2-[4-[(E)-pent-3-enyl]phenyl]ethynyl]-2-(trifluoromethoxy)benzene.
| Compound Name | 1,3-difluoro-5-[2-[4-[(E)-pent-3-enyl]phenyl]ethynyl]-2-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 139750895 |
| Molecular Formula | C20H15F5O |
| Molecular Weight | 366.33 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 1,3-difluoro-5-[2-[4-[(E)-pent-3-enyl]phenyl]ethynyl]-2-(trifluoromethoxy)benzene |
| SMILES | C/C=C/CCc1ccc(C#Cc2cc(F)c(OC(F)(F)F)c(F)c2)cc1 |
| InChI | InChI=1S/C20H15F5O/c1-2-3-4-5-14-6-8-15(9-7-14)10-11-16-12-17(21)19(18(22)13-16)26-20(23,24)25/h2-3,6-9,12-13H,4-5H2,1H3/b3-2+ |
| InChIKey | OPHKONHLLWRRRQ-NSCUHMNNSA-N |
| XLogP | 5.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.33 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|