C19H16F5NO — CID 139780598
N-[3,5-difluoro-4-(trifluoromethoxy)phenyl]-1-[4-[(E)-pent-3-enyl]phenyl]methanimine (PubChem CID 139780598) has the molecular formula C19H16F5NO and a molecular weight of 369.33 g/mol. Its IUPAC name is N-[3,5-difluoro-4-(trifluoromethoxy)phenyl]-1-[4-[(E)-pent-3-enyl]phenyl]methanimine.
| Compound Name | N-[3,5-difluoro-4-(trifluoromethoxy)phenyl]-1-[4-[(E)-pent-3-enyl]phenyl]methanimine |
|---|---|
| PubChem CID | 139780598 |
| Molecular Formula | C19H16F5NO |
| Molecular Weight | 369.33 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | N-[3,5-difluoro-4-(trifluoromethoxy)phenyl]-1-[4-[(E)-pent-3-enyl]phenyl]methanimine |
| SMILES | C/C=C/CCc1ccc(/C=N/c2cc(F)c(OC(F)(F)F)c(F)c2)cc1 |
| InChI | InChI=1S/C19H16F5NO/c1-2-3-4-5-13-6-8-14(9-7-13)12-25-15-10-16(20)18(17(21)11-15)26-19(22,23)24/h2-3,6-12H,4-5H2,1H3/b3-2+,25-12+ |
| InChIKey | ZTESZIIIVRAPGP-JRUCXRJDSA-N |
| XLogP | 6.12 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.33 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|