C24H19F4N — CID 139780616
N-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]-1-[4-[(E)-pent-3-enyl]phenyl]methanimine (PubChem CID 139780616) has the molecular formula C24H19F4N and a molecular weight of 397.42 g/mol. Its IUPAC name is N-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]-1-[4-[(E)-pent-3-enyl]phenyl]methanimine.
| Compound Name | N-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]-1-[4-[(E)-pent-3-enyl]phenyl]methanimine |
|---|---|
| PubChem CID | 139780616 |
| Molecular Formula | C24H19F4N |
| Molecular Weight | 397.42 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | N-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]-1-[4-[(E)-pent-3-enyl]phenyl]methanimine |
| SMILES | C/C=C/CCc1ccc(/C=N/c2ccc(-c3cc(F)c(F)c(F)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C24H19F4N/c1-2-3-4-5-16-6-8-17(9-7-16)15-29-19-10-11-20(21(25)14-19)18-12-22(26)24(28)23(27)13-18/h2-3,6-15H,4-5H2,1H3/b3-2+,29-15+ |
| InChIKey | YNKYKTBJSXEQIX-MQIDDKFBSA-N |
| XLogP | 7.17 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.42 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|