C25H24FN — CID 139780589
1-(4-but-3-enylphenyl)-N-[4-(4-ethyl-2-fluorophenyl)phenyl]methanimine (PubChem CID 139780589) has the molecular formula C25H24FN and a molecular weight of 357.47 g/mol. Its IUPAC name is 1-(4-but-3-enylphenyl)-N-[4-(4-ethyl-2-fluorophenyl)phenyl]methanimine.
| Compound Name | 1-(4-but-3-enylphenyl)-N-[4-(4-ethyl-2-fluorophenyl)phenyl]methanimine |
|---|---|
| PubChem CID | 139780589 |
| Molecular Formula | C25H24FN |
| Molecular Weight | 357.47 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 1-(4-but-3-enylphenyl)-N-[4-(4-ethyl-2-fluorophenyl)phenyl]methanimine |
| SMILES | C=CCCc1ccc(/C=N/c2ccc(-c3ccc(CC)cc3F)cc2)cc1 |
| InChI | InChI=1S/C25H24FN/c1-3-5-6-20-7-9-21(10-8-20)18-27-23-14-12-22(13-15-23)24-16-11-19(4-2)17-25(24)26/h3,7-18H,1,4-6H2,2H3/b27-18+ |
| InChIKey | GZAFPJISHTYJTH-OVVQPSECSA-N |
| XLogP | 6.92 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.47 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|