C28H29FN2 — CID 54260600
1-(4-but-3-enylphenyl)-N-[[4-(4-butylphenyl)-3-fluorophenyl]methylideneamino]methanimine (PubChem CID 54260600) has the molecular formula C28H29FN2 and a molecular weight of 412.55 g/mol. Its IUPAC name is 1-(4-but-3-enylphenyl)-N-[[4-(4-butylphenyl)-3-fluorophenyl]methylideneamino]methanimine.
| Compound Name | 1-(4-but-3-enylphenyl)-N-[[4-(4-butylphenyl)-3-fluorophenyl]methylideneamino]methanimine |
|---|---|
| PubChem CID | 54260600 |
| Molecular Formula | C28H29FN2 |
| Molecular Weight | 412.55 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | 1-(4-but-3-enylphenyl)-N-[[4-(4-butylphenyl)-3-fluorophenyl]methylideneamino]methanimine |
| SMILES | C=CCCc1ccc(C=NN=Cc2ccc(-c3ccc(CCCC)cc3)c(F)c2)cc1 |
| InChI | InChI=1S/C28H29FN2/c1-3-5-7-22-9-11-24(12-10-22)20-30-31-21-25-15-18-27(28(29)19-25)26-16-13-23(14-17-26)8-6-4-2/h3,9-21H,1,4-8H2,2H3 |
| InChIKey | RDFQOJDVHRVOFY-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.55 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|