C31H35FN2 — CID 54176611
N-[[4-(4-butylphenyl)-3-fluorophenyl]methylideneamino]-1-(4-hept-6-enylphenyl)methanimine (PubChem CID 54176611) has the molecular formula C31H35FN2 and a molecular weight of 454.63 g/mol. Its IUPAC name is N-[[4-(4-butylphenyl)-3-fluorophenyl]methylideneamino]-1-(4-hept-6-enylphenyl)methanimine.
| Compound Name | N-[[4-(4-butylphenyl)-3-fluorophenyl]methylideneamino]-1-(4-hept-6-enylphenyl)methanimine |
|---|---|
| PubChem CID | 54176611 |
| Molecular Formula | C31H35FN2 |
| Molecular Weight | 454.63 g/mol |
| Exact Mass | 454.28 |
| IUPAC Name | N-[[4-(4-butylphenyl)-3-fluorophenyl]methylideneamino]-1-(4-hept-6-enylphenyl)methanimine |
| SMILES | C=CCCCCCc1ccc(C=NN=Cc2ccc(-c3ccc(CCCC)cc3)c(F)c2)cc1 |
| InChI | InChI=1S/C31H35FN2/c1-3-5-7-8-9-11-26-12-14-27(15-13-26)23-33-34-24-28-18-21-30(31(32)22-28)29-19-16-25(17-20-29)10-6-4-2/h3,12-24H,1,4-11H2,2H3 |
| InChIKey | OYVJDDQUVWTSAM-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.63 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|