C25H23FN2 — CID 54281249
1-(4-but-3-enylphenyl)-N-[[4-(2-fluoro-4-methylphenyl)phenyl]methylideneamino]methanimine (PubChem CID 54281249) has the molecular formula C25H23FN2 and a molecular weight of 370.47 g/mol. Its IUPAC name is 1-(4-but-3-enylphenyl)-N-[[4-(2-fluoro-4-methylphenyl)phenyl]methylideneamino]methanimine.
| Compound Name | 1-(4-but-3-enylphenyl)-N-[[4-(2-fluoro-4-methylphenyl)phenyl]methylideneamino]methanimine |
|---|---|
| PubChem CID | 54281249 |
| Molecular Formula | C25H23FN2 |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 1-(4-but-3-enylphenyl)-N-[[4-(2-fluoro-4-methylphenyl)phenyl]methylideneamino]methanimine |
| SMILES | C=CCCc1ccc(C=NN=Cc2ccc(-c3ccc(C)cc3F)cc2)cc1 |
| InChI | InChI=1S/C25H23FN2/c1-3-4-5-20-7-9-21(10-8-20)17-27-28-18-22-11-13-23(14-12-22)24-15-6-19(2)16-25(24)26/h3,6-18H,1,4-5H2,2H3 |
| InChIKey | RQXYHSDGPQWRCJ-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|