C26H25FN2 — CID 54082763
1-(4-but-3-enylphenyl)-N-[[4-(4-ethylphenyl)-3-fluorophenyl]methylideneamino]methanimine (PubChem CID 54082763) has the molecular formula C26H25FN2 and a molecular weight of 384.50 g/mol. Its IUPAC name is 1-(4-but-3-enylphenyl)-N-[[4-(4-ethylphenyl)-3-fluorophenyl]methylideneamino]methanimine.
| Compound Name | 1-(4-but-3-enylphenyl)-N-[[4-(4-ethylphenyl)-3-fluorophenyl]methylideneamino]methanimine |
|---|---|
| PubChem CID | 54082763 |
| Molecular Formula | C26H25FN2 |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 1-(4-but-3-enylphenyl)-N-[[4-(4-ethylphenyl)-3-fluorophenyl]methylideneamino]methanimine |
| SMILES | C=CCCc1ccc(C=NN=Cc2ccc(-c3ccc(CC)cc3)c(F)c2)cc1 |
| InChI | InChI=1S/C26H25FN2/c1-3-5-6-21-7-9-22(10-8-21)18-28-29-19-23-13-16-25(26(27)17-23)24-14-11-20(4-2)12-15-24/h3,7-19H,1,4-6H2,2H3 |
| InChIKey | MOGXICAYOUVXJR-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|