C25H25F — CID 76678385
1-(4-ethylphenyl)-2-fluoro-4-(4-pent-3-enylphenyl)benzene (PubChem CID 76678385) has the molecular formula C25H25F and a molecular weight of 344.47 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-2-fluoro-4-(4-pent-3-enylphenyl)benzene.
| Compound Name | 1-(4-ethylphenyl)-2-fluoro-4-(4-pent-3-enylphenyl)benzene |
|---|---|
| PubChem CID | 76678385 |
| Molecular Formula | C25H25F |
| Molecular Weight | 344.47 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | 1-(4-ethylphenyl)-2-fluoro-4-(4-pent-3-enylphenyl)benzene |
| SMILES | CC=CCCc1ccc(-c2ccc(-c3ccc(CC)cc3)c(F)c2)cc1 |
| InChI | InChI=1S/C25H25F/c1-3-5-6-7-20-10-12-21(13-11-20)23-16-17-24(25(26)18-23)22-14-8-19(4-2)9-15-22/h3,5,8-18H,4,6-7H2,1-2H3 |
| InChIKey | OOEWGMFONPTPMU-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.47 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|