C23H21FS — CID 129130534
4-[3-fluoro-4-[4-[(E)-pent-3-enyl]phenyl]phenyl]benzenethiol (PubChem CID 129130534) has the molecular formula C23H21FS and a molecular weight of 348.49 g/mol. Its IUPAC name is 4-[3-fluoro-4-[4-[(E)-pent-3-enyl]phenyl]phenyl]benzenethiol.
| Compound Name | 4-[3-fluoro-4-[4-[(E)-pent-3-enyl]phenyl]phenyl]benzenethiol |
|---|---|
| PubChem CID | 129130534 |
| Molecular Formula | C23H21FS |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 4-[3-fluoro-4-[4-[(E)-pent-3-enyl]phenyl]phenyl]benzenethiol |
| SMILES | C/C=C/CCc1ccc(-c2ccc(-c3ccc(S)cc3)cc2F)cc1 |
| InChI | InChI=1S/C23H21FS/c1-2-3-4-5-17-6-8-19(9-7-17)22-15-12-20(16-23(22)24)18-10-13-21(25)14-11-18/h2-3,6-16,25H,4-5H2,1H3/b3-2+ |
| InChIKey | MUYFNYLUSKBVPV-NSCUHMNNSA-N |
| XLogP | 6.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|