C18H14F6 — CID 88998789
1,3-difluoro-5-[2-fluoro-4-[(E)-pent-3-enyl]phenyl]-2-(trifluoromethyl)benzene (PubChem CID 88998789) has the molecular formula C18H14F6 and a molecular weight of 344.30 g/mol. Its IUPAC name is 1,3-difluoro-5-[2-fluoro-4-[(E)-pent-3-enyl]phenyl]-2-(trifluoromethyl)benzene.
| Compound Name | 1,3-difluoro-5-[2-fluoro-4-[(E)-pent-3-enyl]phenyl]-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 88998789 |
| Molecular Formula | C18H14F6 |
| Molecular Weight | 344.30 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 1,3-difluoro-5-[2-fluoro-4-[(E)-pent-3-enyl]phenyl]-2-(trifluoromethyl)benzene |
| SMILES | C/C=C/CCc1ccc(-c2cc(F)c(C(F)(F)F)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C18H14F6/c1-2-3-4-5-11-6-7-13(14(19)8-11)12-9-15(20)17(16(21)10-12)18(22,23)24/h2-3,6-10H,4-5H2,1H3/b3-2+ |
| InChIKey | CIVBKLBBQNQESD-NSCUHMNNSA-N |
| XLogP | 6.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.30 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|