C23H20F4O — CID 139855856
2-[2-fluoro-4-[(E)-pent-3-enyl]phenyl]-6-(2,2,2-trifluoroethoxy)naphthalene (PubChem CID 139855856) has the molecular formula C23H20F4O and a molecular weight of 388.40 g/mol. Its IUPAC name is 2-[2-fluoro-4-[(E)-pent-3-enyl]phenyl]-6-(2,2,2-trifluoroethoxy)naphthalene.
| Compound Name | 2-[2-fluoro-4-[(E)-pent-3-enyl]phenyl]-6-(2,2,2-trifluoroethoxy)naphthalene |
|---|---|
| PubChem CID | 139855856 |
| Molecular Formula | C23H20F4O |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 2-[2-fluoro-4-[(E)-pent-3-enyl]phenyl]-6-(2,2,2-trifluoroethoxy)naphthalene |
| SMILES | C/C=C/CCc1ccc(-c2ccc3cc(OCC(F)(F)F)ccc3c2)c(F)c1 |
| InChI | InChI=1S/C23H20F4O/c1-2-3-4-5-16-6-11-21(22(24)12-16)19-8-7-18-14-20(10-9-17(18)13-19)28-15-23(25,26)27/h2-3,6-14H,4-5,15H2,1H3/b3-2+ |
| InChIKey | OOJYINKFAJGFIG-NSCUHMNNSA-N |
| XLogP | 7.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|