C29H21F7O — CID 139855536
6-[4-[2,6-difluoro-4-[(E)-pent-3-enyl]phenyl]-2-fluorophenyl]-1-fluoro-2-(2,2,2-trifluoroethoxy)naphthalene (PubChem CID 139855536) has the molecular formula C29H21F7O and a molecular weight of 518.47 g/mol. Its IUPAC name is 6-[4-[2,6-difluoro-4-[(E)-pent-3-enyl]phenyl]-2-fluorophenyl]-1-fluoro-2-(2,2,2-trifluoroethoxy)naphthalene.
| Compound Name | 6-[4-[2,6-difluoro-4-[(E)-pent-3-enyl]phenyl]-2-fluorophenyl]-1-fluoro-2-(2,2,2-trifluoroethoxy)naphthalene |
|---|---|
| PubChem CID | 139855536 |
| Molecular Formula | C29H21F7O |
| Molecular Weight | 518.47 g/mol |
| Exact Mass | 518.15 |
| IUPAC Name | 6-[4-[2,6-difluoro-4-[(E)-pent-3-enyl]phenyl]-2-fluorophenyl]-1-fluoro-2-(2,2,2-trifluoroethoxy)naphthalene |
| SMILES | C/C=C/CCc1cc(F)c(-c2ccc(-c3ccc4c(F)c(OCC(F)(F)F)ccc4c3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C29H21F7O/c1-2-3-4-5-17-12-24(31)27(25(32)13-17)20-7-9-21(23(30)15-20)18-6-10-22-19(14-18)8-11-26(28(22)33)37-16-29(34,35)36/h2-3,6-15H,4-5,16H2,1H3/b3-2+ |
| InChIKey | VUDLSNPZIMKDAY-NSCUHMNNSA-N |
| XLogP | 9.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.47 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|