C29H23F7O — CID 139856403
6-[2,6-difluoro-4-(2-fluoro-4-pentylphenyl)phenyl]-1-fluoro-2-(2,2,2-trifluoroethoxy)naphthalene (PubChem CID 139856403) has the molecular formula C29H23F7O and a molecular weight of 520.49 g/mol. Its IUPAC name is 6-[2,6-difluoro-4-(2-fluoro-4-pentylphenyl)phenyl]-1-fluoro-2-(2,2,2-trifluoroethoxy)naphthalene.
| Compound Name | 6-[2,6-difluoro-4-(2-fluoro-4-pentylphenyl)phenyl]-1-fluoro-2-(2,2,2-trifluoroethoxy)naphthalene |
|---|---|
| PubChem CID | 139856403 |
| Molecular Formula | C29H23F7O |
| Molecular Weight | 520.49 g/mol |
| Exact Mass | 520.16 |
| IUPAC Name | 6-[2,6-difluoro-4-(2-fluoro-4-pentylphenyl)phenyl]-1-fluoro-2-(2,2,2-trifluoroethoxy)naphthalene |
| SMILES | CCCCCc1ccc(-c2cc(F)c(-c3ccc4c(F)c(OCC(F)(F)F)ccc4c3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C29H23F7O/c1-2-3-4-5-17-6-9-21(23(30)12-17)20-14-24(31)27(25(32)15-20)19-7-10-22-18(13-19)8-11-26(28(22)33)37-16-29(34,35)36/h6-15H,2-5,16H2,1H3 |
| InChIKey | JZJHEGUCLCMAJC-UHFFFAOYSA-N |
| XLogP | 9.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.49 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|