C23H20F6O — CID 139856604
6-(2,6-difluoro-4-pentylphenyl)-1-fluoro-2-(2,2,2-trifluoroethoxy)naphthalene (PubChem CID 139856604) has the molecular formula C23H20F6O and a molecular weight of 426.40 g/mol. Its IUPAC name is 6-(2,6-difluoro-4-pentylphenyl)-1-fluoro-2-(2,2,2-trifluoroethoxy)naphthalene.
| Compound Name | 6-(2,6-difluoro-4-pentylphenyl)-1-fluoro-2-(2,2,2-trifluoroethoxy)naphthalene |
|---|---|
| PubChem CID | 139856604 |
| Molecular Formula | C23H20F6O |
| Molecular Weight | 426.40 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 6-(2,6-difluoro-4-pentylphenyl)-1-fluoro-2-(2,2,2-trifluoroethoxy)naphthalene |
| SMILES | CCCCCc1cc(F)c(-c2ccc3c(F)c(OCC(F)(F)F)ccc3c2)c(F)c1 |
| InChI | InChI=1S/C23H20F6O/c1-2-3-4-5-14-10-18(24)21(19(25)11-14)16-6-8-17-15(12-16)7-9-20(22(17)26)30-13-23(27,28)29/h6-12H,2-5,13H2,1H3 |
| InChIKey | SOTAEYZKLOFSKZ-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.40 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|