C31H30F6N2O — CID 139874769
2-[6-[2-[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]ethyl]-5-fluoronaphthalen-2-yl]-5-heptylpyrimidine (PubChem CID 139874769) has the molecular formula C31H30F6N2O and a molecular weight of 560.58 g/mol. Its IUPAC name is 2-[6-[2-[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]ethyl]-5-fluoronaphthalen-2-yl]-5-heptylpyrimidine.
| Compound Name | 2-[6-[2-[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]ethyl]-5-fluoronaphthalen-2-yl]-5-heptylpyrimidine |
|---|---|
| PubChem CID | 139874769 |
| Molecular Formula | C31H30F6N2O |
| Molecular Weight | 560.58 g/mol |
| Exact Mass | 560.23 |
| IUPAC Name | 2-[6-[2-[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]ethyl]-5-fluoronaphthalen-2-yl]-5-heptylpyrimidine |
| SMILES | CCCCCCCc1cnc(-c2ccc3c(F)c(CCc4cc(F)c(OCC(F)(F)F)c(F)c4)ccc3c2)nc1 |
| InChI | InChI=1S/C31H30F6N2O/c1-2-3-4-5-6-7-21-17-38-30(39-18-21)24-12-13-25-23(16-24)11-10-22(28(25)34)9-8-20-14-26(32)29(27(33)15-20)40-19-31(35,36)37/h10-18H,2-9,19H2,1H3 |
| InChIKey | WLNDVEMKNHBEOW-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.58 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|