C27H25F3N2 — CID 139870946
2-[6-[2-(3,4-difluorophenyl)ethyl]-5-fluoronaphthalen-2-yl]-5-pentylpyrimidine (PubChem CID 139870946) has the molecular formula C27H25F3N2 and a molecular weight of 434.51 g/mol. Its IUPAC name is 2-[6-[2-(3,4-difluorophenyl)ethyl]-5-fluoronaphthalen-2-yl]-5-pentylpyrimidine.
| Compound Name | 2-[6-[2-(3,4-difluorophenyl)ethyl]-5-fluoronaphthalen-2-yl]-5-pentylpyrimidine |
|---|---|
| PubChem CID | 139870946 |
| Molecular Formula | C27H25F3N2 |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 2-[6-[2-(3,4-difluorophenyl)ethyl]-5-fluoronaphthalen-2-yl]-5-pentylpyrimidine |
| SMILES | CCCCCc1cnc(-c2ccc3c(F)c(CCc4ccc(F)c(F)c4)ccc3c2)nc1 |
| InChI | InChI=1S/C27H25F3N2/c1-2-3-4-5-19-16-31-27(32-17-19)22-11-12-23-21(15-22)10-9-20(26(23)30)8-6-18-7-13-24(28)25(29)14-18/h7,9-17H,2-6,8H2,1H3 |
| InChIKey | MXQUFKLNENNKGP-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|