C31H30F5N — CID 139874836
2-[5-fluoro-6-[2-[3-fluoro-4-(trifluoromethyl)phenyl]ethyl]naphthalen-2-yl]-5-heptylpyridine (PubChem CID 139874836) has the molecular formula C31H30F5N and a molecular weight of 511.58 g/mol. Its IUPAC name is 2-[5-fluoro-6-[2-[3-fluoro-4-(trifluoromethyl)phenyl]ethyl]naphthalen-2-yl]-5-heptylpyridine.
| Compound Name | 2-[5-fluoro-6-[2-[3-fluoro-4-(trifluoromethyl)phenyl]ethyl]naphthalen-2-yl]-5-heptylpyridine |
|---|---|
| PubChem CID | 139874836 |
| Molecular Formula | C31H30F5N |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 511.23 |
| IUPAC Name | 2-[5-fluoro-6-[2-[3-fluoro-4-(trifluoromethyl)phenyl]ethyl]naphthalen-2-yl]-5-heptylpyridine |
| SMILES | CCCCCCCc1ccc(-c2ccc3c(F)c(CCc4ccc(C(F)(F)F)c(F)c4)ccc3c2)nc1 |
| InChI | InChI=1S/C31H30F5N/c1-2-3-4-5-6-7-22-10-17-29(37-20-22)25-14-15-26-24(19-25)13-12-23(30(26)33)11-8-21-9-16-27(28(32)18-21)31(34,35)36/h9-10,12-20H,2-8,11H2,1H3 |
| InChIKey | WXIBWTJOMFIZIN-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|