C31H31F5N2 — CID 139874758
2-[2-[5-fluoro-6-[2-[3-fluoro-4-(trifluoromethyl)phenyl]ethyl]naphthalen-2-yl]ethyl]-5-hexylpyrimidine (PubChem CID 139874758) has the molecular formula C31H31F5N2 and a molecular weight of 526.59 g/mol. Its IUPAC name is 2-[2-[5-fluoro-6-[2-[3-fluoro-4-(trifluoromethyl)phenyl]ethyl]naphthalen-2-yl]ethyl]-5-hexylpyrimidine.
| Compound Name | 2-[2-[5-fluoro-6-[2-[3-fluoro-4-(trifluoromethyl)phenyl]ethyl]naphthalen-2-yl]ethyl]-5-hexylpyrimidine |
|---|---|
| PubChem CID | 139874758 |
| Molecular Formula | C31H31F5N2 |
| Molecular Weight | 526.59 g/mol |
| Exact Mass | 526.24 |
| IUPAC Name | 2-[2-[5-fluoro-6-[2-[3-fluoro-4-(trifluoromethyl)phenyl]ethyl]naphthalen-2-yl]ethyl]-5-hexylpyrimidine |
| SMILES | CCCCCCc1cnc(CCc2ccc3c(F)c(CCc4ccc(C(F)(F)F)c(F)c4)ccc3c2)nc1 |
| InChI | InChI=1S/C31H31F5N2/c1-2-3-4-5-6-23-19-37-29(38-20-23)16-10-21-8-14-26-25(17-21)13-12-24(30(26)33)11-7-22-9-15-27(28(32)18-22)31(34,35)36/h8-9,12-15,17-20H,2-7,10-11,16H2,1H3 |
| InChIKey | KELABSBIRWYBQE-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.59 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|