C30H29F5N2O — CID 139873979
2-[2-[5-fluoro-6-[2-[3-fluoro-4-(trifluoromethoxy)phenyl]ethyl]naphthalen-2-yl]ethyl]-5-pentylpyrimidine (PubChem CID 139873979) has the molecular formula C30H29F5N2O and a molecular weight of 528.57 g/mol. Its IUPAC name is 2-[2-[5-fluoro-6-[2-[3-fluoro-4-(trifluoromethoxy)phenyl]ethyl]naphthalen-2-yl]ethyl]-5-pentylpyrimidine.
| Compound Name | 2-[2-[5-fluoro-6-[2-[3-fluoro-4-(trifluoromethoxy)phenyl]ethyl]naphthalen-2-yl]ethyl]-5-pentylpyrimidine |
|---|---|
| PubChem CID | 139873979 |
| Molecular Formula | C30H29F5N2O |
| Molecular Weight | 528.57 g/mol |
| Exact Mass | 528.22 |
| IUPAC Name | 2-[2-[5-fluoro-6-[2-[3-fluoro-4-(trifluoromethoxy)phenyl]ethyl]naphthalen-2-yl]ethyl]-5-pentylpyrimidine |
| SMILES | CCCCCc1cnc(CCc2ccc3c(F)c(CCc4ccc(OC(F)(F)F)c(F)c4)ccc3c2)nc1 |
| InChI | InChI=1S/C30H29F5N2O/c1-2-3-4-5-22-18-36-28(37-19-22)15-9-20-7-13-25-24(16-20)12-11-23(29(25)32)10-6-21-8-14-27(26(31)17-21)38-30(33,34)35/h7-8,11-14,16-19H,2-6,9-10,15H2,1H3 |
| InChIKey | GSBUGBXGKIVGFN-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.57 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|