C32H34F4N2O2 — CID 139871770
2-[2-[5-fluoro-6-[2-[4-(trifluoromethoxy)phenyl]ethyl]naphthalen-2-yl]ethyl]-5-heptoxypyrimidine (PubChem CID 139871770) has the molecular formula C32H34F4N2O2 and a molecular weight of 554.63 g/mol. Its IUPAC name is 2-[2-[5-fluoro-6-[2-[4-(trifluoromethoxy)phenyl]ethyl]naphthalen-2-yl]ethyl]-5-heptoxypyrimidine.
| Compound Name | 2-[2-[5-fluoro-6-[2-[4-(trifluoromethoxy)phenyl]ethyl]naphthalen-2-yl]ethyl]-5-heptoxypyrimidine |
|---|---|
| PubChem CID | 139871770 |
| Molecular Formula | C32H34F4N2O2 |
| Molecular Weight | 554.63 g/mol |
| Exact Mass | 554.26 |
| IUPAC Name | 2-[2-[5-fluoro-6-[2-[4-(trifluoromethoxy)phenyl]ethyl]naphthalen-2-yl]ethyl]-5-heptoxypyrimidine |
| SMILES | CCCCCCCOc1cnc(CCc2ccc3c(F)c(CCc4ccc(OC(F)(F)F)cc4)ccc3c2)nc1 |
| InChI | InChI=1S/C32H34F4N2O2/c1-2-3-4-5-6-19-39-28-21-37-30(38-22-28)18-11-24-10-17-29-26(20-24)14-13-25(31(29)33)12-7-23-8-15-27(16-9-23)40-32(34,35)36/h8-10,13-17,20-22H,2-7,11-12,18-19H2,1H3 |
| InChIKey | IFWIGGVSQIXDQG-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.63 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|