C28H26F4N2O — CID 139872835
5-butoxy-2-[2-[5-fluoro-6-[2-(3,4,5-trifluorophenyl)ethyl]naphthalen-2-yl]ethyl]pyrimidine (PubChem CID 139872835) has the molecular formula C28H26F4N2O and a molecular weight of 482.52 g/mol. Its IUPAC name is 5-butoxy-2-[2-[5-fluoro-6-[2-(3,4,5-trifluorophenyl)ethyl]naphthalen-2-yl]ethyl]pyrimidine.
| Compound Name | 5-butoxy-2-[2-[5-fluoro-6-[2-(3,4,5-trifluorophenyl)ethyl]naphthalen-2-yl]ethyl]pyrimidine |
|---|---|
| PubChem CID | 139872835 |
| Molecular Formula | C28H26F4N2O |
| Molecular Weight | 482.52 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | 5-butoxy-2-[2-[5-fluoro-6-[2-(3,4,5-trifluorophenyl)ethyl]naphthalen-2-yl]ethyl]pyrimidine |
| SMILES | CCCCOc1cnc(CCc2ccc3c(F)c(CCc4cc(F)c(F)c(F)c4)ccc3c2)nc1 |
| InChI | InChI=1S/C28H26F4N2O/c1-2-3-12-35-22-16-33-26(34-17-22)11-6-18-5-10-23-21(13-18)9-8-20(27(23)31)7-4-19-14-24(29)28(32)25(30)15-19/h5,8-10,13-17H,2-4,6-7,11-12H2,1H3 |
| InChIKey | BYNXVRCNDIRXRU-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.52 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|