C29H27F5N2O2 — CID 139873550
5-butoxy-2-[2-[5-fluoro-6-[2-[3-fluoro-4-(trifluoromethoxy)phenyl]ethyl]naphthalen-2-yl]ethyl]pyrimidine (PubChem CID 139873550) has the molecular formula C29H27F5N2O2 and a molecular weight of 530.54 g/mol. Its IUPAC name is 5-butoxy-2-[2-[5-fluoro-6-[2-[3-fluoro-4-(trifluoromethoxy)phenyl]ethyl]naphthalen-2-yl]ethyl]pyrimidine.
| Compound Name | 5-butoxy-2-[2-[5-fluoro-6-[2-[3-fluoro-4-(trifluoromethoxy)phenyl]ethyl]naphthalen-2-yl]ethyl]pyrimidine |
|---|---|
| PubChem CID | 139873550 |
| Molecular Formula | C29H27F5N2O2 |
| Molecular Weight | 530.54 g/mol |
| Exact Mass | 530.20 |
| IUPAC Name | 5-butoxy-2-[2-[5-fluoro-6-[2-[3-fluoro-4-(trifluoromethoxy)phenyl]ethyl]naphthalen-2-yl]ethyl]pyrimidine |
| SMILES | CCCCOc1cnc(CCc2ccc3c(F)c(CCc4ccc(OC(F)(F)F)c(F)c4)ccc3c2)nc1 |
| InChI | InChI=1S/C29H27F5N2O2/c1-2-3-14-37-23-17-35-27(36-18-23)13-7-19-5-11-24-22(15-19)10-9-21(28(24)31)8-4-20-6-12-26(25(30)16-20)38-29(32,33)34/h5-6,9-12,15-18H,2-4,7-8,13-14H2,1H3 |
| InChIKey | NLQRVAHIGZRYKS-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.54 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|