C29H26F6N2O2 — CID 139874599
5-butoxy-2-[2-[6-[2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]ethyl]-5-fluoronaphthalen-2-yl]ethyl]pyrimidine (PubChem CID 139874599) has the molecular formula C29H26F6N2O2 and a molecular weight of 548.53 g/mol. Its IUPAC name is 5-butoxy-2-[2-[6-[2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]ethyl]-5-fluoronaphthalen-2-yl]ethyl]pyrimidine.
| Compound Name | 5-butoxy-2-[2-[6-[2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]ethyl]-5-fluoronaphthalen-2-yl]ethyl]pyrimidine |
|---|---|
| PubChem CID | 139874599 |
| Molecular Formula | C29H26F6N2O2 |
| Molecular Weight | 548.53 g/mol |
| Exact Mass | 548.19 |
| IUPAC Name | 5-butoxy-2-[2-[6-[2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]ethyl]-5-fluoronaphthalen-2-yl]ethyl]pyrimidine |
| SMILES | CCCCOc1cnc(CCc2ccc3c(F)c(CCc4cc(F)c(OC(F)(F)F)c(F)c4)ccc3c2)nc1 |
| InChI | InChI=1S/C29H26F6N2O2/c1-2-3-12-38-22-16-36-26(37-17-22)11-6-18-5-10-23-21(13-18)9-8-20(27(23)32)7-4-19-14-24(30)28(25(31)15-19)39-29(33,34)35/h5,8-10,13-17H,2-4,6-7,11-12H2,1H3 |
| InChIKey | MKBIEVDWUOCEKL-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.53 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|