C33H33F6NO — CID 139871752
2-[2-[6-[2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]ethyl]-5-fluoronaphthalen-2-yl]ethyl]-4-heptylpyridine (PubChem CID 139871752) has the molecular formula C33H33F6NO and a molecular weight of 573.62 g/mol. Its IUPAC name is 2-[2-[6-[2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]ethyl]-5-fluoronaphthalen-2-yl]ethyl]-4-heptylpyridine.
| Compound Name | 2-[2-[6-[2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]ethyl]-5-fluoronaphthalen-2-yl]ethyl]-4-heptylpyridine |
|---|---|
| PubChem CID | 139871752 |
| Molecular Formula | C33H33F6NO |
| Molecular Weight | 573.62 g/mol |
| Exact Mass | 573.25 |
| IUPAC Name | 2-[2-[6-[2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]ethyl]-5-fluoronaphthalen-2-yl]ethyl]-4-heptylpyridine |
| SMILES | CCCCCCCc1ccnc(CCc2ccc3c(F)c(CCc4cc(F)c(OC(F)(F)F)c(F)c4)ccc3c2)c1 |
| InChI | InChI=1S/C33H33F6NO/c1-2-3-4-5-6-7-22-16-17-40-27(19-22)14-9-23-10-15-28-26(18-23)13-12-25(31(28)36)11-8-24-20-29(34)32(30(35)21-24)41-33(37,38)39/h10,12-13,15-21H,2-9,11,14H2,1H3 |
| InChIKey | IJNPRBSURUZVCO-UHFFFAOYSA-N |
| XLogP | 9.63 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.62 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|