C30H28F6N2O — CID 139871071
2-[6-[2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]ethyl]-5-fluoronaphthalen-2-yl]-4-heptylpyrimidine (PubChem CID 139871071) has the molecular formula C30H28F6N2O and a molecular weight of 546.56 g/mol. Its IUPAC name is 2-[6-[2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]ethyl]-5-fluoronaphthalen-2-yl]-4-heptylpyrimidine.
| Compound Name | 2-[6-[2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]ethyl]-5-fluoronaphthalen-2-yl]-4-heptylpyrimidine |
|---|---|
| PubChem CID | 139871071 |
| Molecular Formula | C30H28F6N2O |
| Molecular Weight | 546.56 g/mol |
| Exact Mass | 546.21 |
| IUPAC Name | 2-[6-[2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]ethyl]-5-fluoronaphthalen-2-yl]-4-heptylpyrimidine |
| SMILES | CCCCCCCc1ccnc(-c2ccc3c(F)c(CCc4cc(F)c(OC(F)(F)F)c(F)c4)ccc3c2)n1 |
| InChI | InChI=1S/C30H28F6N2O/c1-2-3-4-5-6-7-23-14-15-37-29(38-23)22-12-13-24-21(18-22)11-10-20(27(24)33)9-8-19-16-25(31)28(26(32)17-19)39-30(34,35)36/h10-18H,2-9H2,1H3 |
| InChIKey | HEXFEGOLJHBXIO-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.56 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|