C32H28F8O — CID 139875377
6-(2,6-difluoro-4-hexylphenyl)-2-[2-[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]ethyl]-1-fluoronaphthalene (PubChem CID 139875377) has the molecular formula C32H28F8O and a molecular weight of 580.56 g/mol. Its IUPAC name is 6-(2,6-difluoro-4-hexylphenyl)-2-[2-[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]ethyl]-1-fluoronaphthalene.
| Compound Name | 6-(2,6-difluoro-4-hexylphenyl)-2-[2-[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]ethyl]-1-fluoronaphthalene |
|---|---|
| PubChem CID | 139875377 |
| Molecular Formula | C32H28F8O |
| Molecular Weight | 580.56 g/mol |
| Exact Mass | 580.20 |
| IUPAC Name | 6-(2,6-difluoro-4-hexylphenyl)-2-[2-[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]ethyl]-1-fluoronaphthalene |
| SMILES | CCCCCCc1cc(F)c(-c2ccc3c(F)c(CCc4cc(F)c(OCC(F)(F)F)c(F)c4)ccc3c2)c(F)c1 |
| InChI | InChI=1S/C32H28F8O/c1-2-3-4-5-6-19-13-25(33)29(26(34)14-19)23-11-12-24-22(17-23)10-9-21(30(24)37)8-7-20-15-27(35)31(28(36)16-20)41-18-32(38,39)40/h9-17H,2-8,18H2,1H3 |
| InChIKey | RPMLIHJIVZVVCL-UHFFFAOYSA-N |
| XLogP | 10.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.56 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|