C33H38F6O — CID 139873201
2-[2-[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]ethyl]-1-fluoro-6-(4-heptylcyclohexyl)naphthalene (PubChem CID 139873201) has the molecular formula C33H38F6O and a molecular weight of 564.65 g/mol. Its IUPAC name is 2-[2-[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]ethyl]-1-fluoro-6-(4-heptylcyclohexyl)naphthalene.
| Compound Name | 2-[2-[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]ethyl]-1-fluoro-6-(4-heptylcyclohexyl)naphthalene |
|---|---|
| PubChem CID | 139873201 |
| Molecular Formula | C33H38F6O |
| Molecular Weight | 564.65 g/mol |
| Exact Mass | 564.28 |
| IUPAC Name | 2-[2-[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]ethyl]-1-fluoro-6-(4-heptylcyclohexyl)naphthalene |
| SMILES | CCCCCCCC1CCC(c2ccc3c(F)c(CCc4cc(F)c(OCC(F)(F)F)c(F)c4)ccc3c2)CC1 |
| InChI | InChI=1S/C33H38F6O/c1-2-3-4-5-6-7-22-8-11-24(12-9-22)26-16-17-28-27(20-26)15-14-25(31(28)36)13-10-23-18-29(34)32(30(35)19-23)40-21-33(37,38)39/h14-20,22,24H,2-13,21H2,1H3 |
| InChIKey | YHDUSGBPTSPWKM-UHFFFAOYSA-N |
| XLogP | 10.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.65 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|