C30H33F5O3 — CID 139872778
2-[5-fluoro-6-[2-[3-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]ethyl]naphthalen-2-yl]-5-hexyl-1,3-dioxane (PubChem CID 139872778) has the molecular formula C30H33F5O3 and a molecular weight of 536.58 g/mol. Its IUPAC name is 2-[5-fluoro-6-[2-[3-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]ethyl]naphthalen-2-yl]-5-hexyl-1,3-dioxane.
| Compound Name | 2-[5-fluoro-6-[2-[3-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]ethyl]naphthalen-2-yl]-5-hexyl-1,3-dioxane |
|---|---|
| PubChem CID | 139872778 |
| Molecular Formula | C30H33F5O3 |
| Molecular Weight | 536.58 g/mol |
| Exact Mass | 536.23 |
| IUPAC Name | 2-[5-fluoro-6-[2-[3-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]ethyl]naphthalen-2-yl]-5-hexyl-1,3-dioxane |
| SMILES | CCCCCCC1COC(c2ccc3c(F)c(CCc4ccc(OCC(F)(F)F)c(F)c4)ccc3c2)OC1 |
| InChI | InChI=1S/C30H33F5O3/c1-2-3-4-5-6-21-17-36-29(37-18-21)24-12-13-25-23(16-24)11-10-22(28(25)32)9-7-20-8-14-27(26(31)15-20)38-19-30(33,34)35/h8,10-16,21,29H,2-7,9,17-19H2,1H3 |
| InChIKey | XKKSKTPXHMBTJR-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.58 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|