C34H33F7O2 — CID 139874793
6-[2-(2,6-difluoro-4-hexoxyphenyl)ethyl]-1-fluoro-2-[2-[3-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]ethyl]naphthalene (PubChem CID 139874793) has the molecular formula C34H33F7O2 and a molecular weight of 606.62 g/mol. Its IUPAC name is 6-[2-(2,6-difluoro-4-hexoxyphenyl)ethyl]-1-fluoro-2-[2-[3-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]ethyl]naphthalene.
| Compound Name | 6-[2-(2,6-difluoro-4-hexoxyphenyl)ethyl]-1-fluoro-2-[2-[3-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]ethyl]naphthalene |
|---|---|
| PubChem CID | 139874793 |
| Molecular Formula | C34H33F7O2 |
| Molecular Weight | 606.62 g/mol |
| Exact Mass | 606.24 |
| IUPAC Name | 6-[2-(2,6-difluoro-4-hexoxyphenyl)ethyl]-1-fluoro-2-[2-[3-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]ethyl]naphthalene |
| SMILES | CCCCCCOc1cc(F)c(CCc2ccc3c(F)c(CCc4ccc(OCC(F)(F)F)c(F)c4)ccc3c2)c(F)c1 |
| InChI | InChI=1S/C34H33F7O2/c1-2-3-4-5-16-42-26-19-29(35)28(30(36)20-26)14-8-22-7-13-27-25(17-22)12-11-24(33(27)38)10-6-23-9-15-32(31(37)18-23)43-21-34(39,40)41/h7,9,11-13,15,17-20H,2-6,8,10,14,16,21H2,1H3 |
| InChIKey | SCCUJVPZLIIBDP-UHFFFAOYSA-N |
| XLogP | 9.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.62 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|