C34H34F6O — CID 139871852
1-fluoro-6-[2-(2-fluoro-4-heptoxyphenyl)ethyl]-2-[2-[3-fluoro-4-(trifluoromethyl)phenyl]ethyl]naphthalene (PubChem CID 139871852) has the molecular formula C34H34F6O and a molecular weight of 572.63 g/mol. Its IUPAC name is 1-fluoro-6-[2-(2-fluoro-4-heptoxyphenyl)ethyl]-2-[2-[3-fluoro-4-(trifluoromethyl)phenyl]ethyl]naphthalene.
| Compound Name | 1-fluoro-6-[2-(2-fluoro-4-heptoxyphenyl)ethyl]-2-[2-[3-fluoro-4-(trifluoromethyl)phenyl]ethyl]naphthalene |
|---|---|
| PubChem CID | 139871852 |
| Molecular Formula | C34H34F6O |
| Molecular Weight | 572.63 g/mol |
| Exact Mass | 572.25 |
| IUPAC Name | 1-fluoro-6-[2-(2-fluoro-4-heptoxyphenyl)ethyl]-2-[2-[3-fluoro-4-(trifluoromethyl)phenyl]ethyl]naphthalene |
| SMILES | CCCCCCCOc1ccc(CCc2ccc3c(F)c(CCc4ccc(C(F)(F)F)c(F)c4)ccc3c2)c(F)c1 |
| InChI | InChI=1S/C34H34F6O/c1-2-3-4-5-6-19-41-28-16-15-25(31(35)22-28)11-7-23-9-17-29-27(20-23)14-13-26(33(29)37)12-8-24-10-18-30(32(36)21-24)34(38,39)40/h9-10,13-18,20-22H,2-8,11-12,19H2,1H3 |
| InChIKey | LUSZVCYIJDHWGP-UHFFFAOYSA-N |
| XLogP | 10.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.63 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|