C32H31F6NO — CID 139873607
2-[2-[6-[2-[3,5-difluoro-4-(trifluoromethyl)phenyl]ethyl]-5-fluoronaphthalen-2-yl]ethyl]-5-hexoxypyridine (PubChem CID 139873607) has the molecular formula C32H31F6NO and a molecular weight of 559.59 g/mol. Its IUPAC name is 2-[2-[6-[2-[3,5-difluoro-4-(trifluoromethyl)phenyl]ethyl]-5-fluoronaphthalen-2-yl]ethyl]-5-hexoxypyridine.
| Compound Name | 2-[2-[6-[2-[3,5-difluoro-4-(trifluoromethyl)phenyl]ethyl]-5-fluoronaphthalen-2-yl]ethyl]-5-hexoxypyridine |
|---|---|
| PubChem CID | 139873607 |
| Molecular Formula | C32H31F6NO |
| Molecular Weight | 559.59 g/mol |
| Exact Mass | 559.23 |
| IUPAC Name | 2-[2-[6-[2-[3,5-difluoro-4-(trifluoromethyl)phenyl]ethyl]-5-fluoronaphthalen-2-yl]ethyl]-5-hexoxypyridine |
| SMILES | CCCCCCOc1ccc(CCc2ccc3c(F)c(CCc4cc(F)c(C(F)(F)F)c(F)c4)ccc3c2)nc1 |
| InChI | InChI=1S/C32H31F6NO/c1-2-3-4-5-16-40-26-14-13-25(39-20-26)12-7-21-8-15-27-24(17-21)11-10-23(31(27)35)9-6-22-18-28(33)30(29(34)19-22)32(36,37)38/h8,10-11,13-15,17-20H,2-7,9,12,16H2,1H3 |
| InChIKey | QJDTUIVEGXWNEX-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.59 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|