C30H29ClF3NO — CID 139873909
2-[2-[6-[2-(4-chloro-3,5-difluorophenyl)ethyl]-5-fluoronaphthalen-2-yl]ethyl]-5-pentoxypyridine (PubChem CID 139873909) has the molecular formula C30H29ClF3NO and a molecular weight of 512.02 g/mol. Its IUPAC name is 2-[2-[6-[2-(4-chloro-3,5-difluorophenyl)ethyl]-5-fluoronaphthalen-2-yl]ethyl]-5-pentoxypyridine.
| Compound Name | 2-[2-[6-[2-(4-chloro-3,5-difluorophenyl)ethyl]-5-fluoronaphthalen-2-yl]ethyl]-5-pentoxypyridine |
|---|---|
| PubChem CID | 139873909 |
| Molecular Formula | C30H29ClF3NO |
| Molecular Weight | 512.02 g/mol |
| Exact Mass | 511.19 |
| IUPAC Name | 2-[2-[6-[2-(4-chloro-3,5-difluorophenyl)ethyl]-5-fluoronaphthalen-2-yl]ethyl]-5-pentoxypyridine |
| SMILES | CCCCCOc1ccc(CCc2ccc3c(F)c(CCc4cc(F)c(Cl)c(F)c4)ccc3c2)nc1 |
| InChI | InChI=1S/C30H29ClF3NO/c1-2-3-4-15-36-25-13-12-24(35-19-25)11-6-20-7-14-26-23(16-20)10-9-22(30(26)34)8-5-21-17-27(32)29(31)28(33)18-21/h7,9-10,12-14,16-19H,2-6,8,11,15H2,1H3 |
| InChIKey | USLMJHXBIHJECG-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.02 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|